C14H22O6 — CID 67902463
[(3aR,6S,6aS)-4-[1-(methoxymethoxy)ethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl] acetate (PubChem CID 67902463) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is [(3aR,6S,6aS)-4-[1-(methoxymethoxy)ethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl] acetate.
| Compound Name | [(3aR,6S,6aS)-4-[1-(methoxymethoxy)ethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl] acetate |
|---|---|
| PubChem CID | 67902463 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [(3aR,6S,6aS)-4-[1-(methoxymethoxy)ethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl] acetate |
| SMILES | COCOC(C)C1=C[C@H](OC(C)=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C14H22O6/c1-8(17-7-16-5)10-6-11(18-9(2)15)13-12(10)19-14(3,4)20-13/h6,8,11-13H,7H2,1-5H3/t8?,11-,12+,13-/m0/s1 |
| InChIKey | KOVQGYZQWPBOJM-LGPYELJSSA-N |
| XLogP | 1.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|