C28H45O3P — CID 67902821
trihydroxy-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]-λ5-phosphane (PubChem CID 67902821) has the molecular formula C28H45O3P and a molecular weight of 460.64 g/mol. Its IUPAC name is trihydroxy-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]-λ5-phosphane.
| Compound Name | trihydroxy-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]-λ5-phosphane |
|---|---|
| PubChem CID | 67902821 |
| Molecular Formula | C28H45O3P |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | trihydroxy-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]-λ5-phosphane |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(P(O)(O)(O)c2ccc(C(C)(C)CC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H45O3P/c1-25(2,3)19-27(7,8)21-11-15-23(16-12-21)32(29,30,31)24-17-13-22(14-18-24)28(9,10)20-26(4,5)6/h11-18,29-31H,19-20H2,1-10H3 |
| InChIKey | ORNIFJICVQMMDF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|