About 4aH-isochromene;hydrochloride
4aH-isochromene;hydrochloride (PubChem CID 67902852) has the molecular formula C9H9ClO
and a molecular weight of 168.62 g/mol. Its IUPAC name is 4aH-isochromene;hydrochloride.
Molecular Properties
| Compound Name | 4aH-isochromene;hydrochloride |
| PubChem CID | 67902852 |
| Molecular Formula | C9H9ClO |
| Molecular Weight | 168.62 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 4aH-isochromene;hydrochloride |
| SMILES | C1=CC2=COC=CC2C=C1.Cl |
| InChI | InChI=1S/C9H8O.ClH/c1-2-4-9-7-10-6-5-8(9)3-1;/h1-8H;1H |
| InChIKey | HLFQSYOVGHSKPP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.62 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4aH-isochromene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4aH-isochromene;hydrochloride?
The IUPAC name of 4aH-isochromene;hydrochloride (CID 67902852) is 4aH-isochromene;hydrochloride.
What is the SMILES notation for 4aH-isochromene;hydrochloride?
The canonical SMILES for 4aH-isochromene;hydrochloride is C1=CC2=COC=CC2C=C1.Cl.
What is the InChIKey of 4aH-isochromene;hydrochloride?
The InChIKey is HLFQSYOVGHSKPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.ClH/c1-2-4-9-7-10-6-5-8(9)3-1;/h1-8H;1H.
What are the key properties of 4aH-isochromene;hydrochloride?
4aH-isochromene;hydrochloride has a molecular weight of 168.62 g/mol, XLogP of 2.58, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4aH-isochromene;hydrochloride is sourced from PubChem (CID 67902852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).