C17H32OSi — CID 67903060
(3,4a,8,8-tetramethyl-2,3,4,5,6,7-hexahydronaphthalen-1-yl)oxy-trimethylsilane (PubChem CID 67903060) has the molecular formula C17H32OSi and a molecular weight of 280.53 g/mol. Its IUPAC name is (3,4a,8,8-tetramethyl-2,3,4,5,6,7-hexahydronaphthalen-1-yl)oxy-trimethylsilane.
| Compound Name | (3,4a,8,8-tetramethyl-2,3,4,5,6,7-hexahydronaphthalen-1-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 67903060 |
| Molecular Formula | C17H32OSi |
| Molecular Weight | 280.53 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | (3,4a,8,8-tetramethyl-2,3,4,5,6,7-hexahydronaphthalen-1-yl)oxy-trimethylsilane |
| SMILES | CC1CC(O[Si](C)(C)C)=C2C(C)(C)CCCC2(C)C1 |
| InChI | InChI=1S/C17H32OSi/c1-13-11-14(18-19(5,6)7)15-16(2,3)9-8-10-17(15,4)12-13/h13H,8-12H2,1-7H3 |
| InChIKey | UPCHYPHGZJGTEE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|