C21H36O5 — CID 67903523
2-[(Z)-4-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-enoxy]-2-methylpropanoic acid (PubChem CID 67903523) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is 2-[(Z)-4-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-enoxy]-2-methylpropanoic acid.
| Compound Name | 2-[(Z)-4-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-enoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 67903523 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 2-[(Z)-4-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-enoxy]-2-methylpropanoic acid |
| SMILES | CCCCCCOC[C@@H]1[C@H](C/C=C\COC(C)(C)C(=O)O)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C21H36O5/c1-4-5-6-8-13-24-15-17-16(18-11-12-19(17)26-18)10-7-9-14-25-21(2,3)20(22)23/h7,9,16-19H,4-6,8,10-15H2,1-3H3,(H,22,23)/b9-7-/t16-,17+,18-,19+/m0/s1 |
| InChIKey | MWWVVUURZUUBOU-RBIRGFPGSA-N |
| XLogP | 4.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|