C27H31N3O2S — CID 67903640
1-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]-3,3-dimethylpiperidine-2,6-dione (PubChem CID 67903640) has the molecular formula C27H31N3O2S and a molecular weight of 461.63 g/mol. Its IUPAC name is 1-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]-3,3-dimethylpiperidine-2,6-dione.
| Compound Name | 1-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]-3,3-dimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 67903640 |
| Molecular Formula | C27H31N3O2S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 1-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]-3,3-dimethylpiperidine-2,6-dione |
| SMILES | Cc1ccc(-c2nc(SCCCN3C(=O)CCC(C)(C)C3=O)[nH]c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H31N3O2S/c1-18-6-10-20(11-7-18)23-24(21-12-8-19(2)9-13-21)29-26(28-23)33-17-5-16-30-22(31)14-15-27(3,4)25(30)32/h6-13H,5,14-17H2,1-4H3,(H,28,29) |
| InChIKey | FRWGRLZDZSUXTO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|