About 4,5-dihydroimidazol-1-yl 3-methylbenzoate
4,5-dihydroimidazol-1-yl 3-methylbenzoate (PubChem CID 67903943) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 4,5-dihydroimidazol-1-yl 3-methylbenzoate.
Molecular Properties
| Compound Name | 4,5-dihydroimidazol-1-yl 3-methylbenzoate |
| PubChem CID | 67903943 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 4,5-dihydroimidazol-1-yl 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)ON2C=NCC2)c1 |
| InChI | InChI=1S/C11H12N2O2/c1-9-3-2-4-10(7-9)11(14)15-13-6-5-12-8-13/h2-4,7-8H,5-6H2,1H3 |
| InChIKey | IGKRQYCWAIWKCK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dihydroimidazol-1-yl 3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroimidazol-1-yl 3-methylbenzoate?
The IUPAC name of 4,5-dihydroimidazol-1-yl 3-methylbenzoate (CID 67903943) is 4,5-dihydroimidazol-1-yl 3-methylbenzoate.
What is the SMILES notation for 4,5-dihydroimidazol-1-yl 3-methylbenzoate?
The canonical SMILES for 4,5-dihydroimidazol-1-yl 3-methylbenzoate is Cc1cccc(C(=O)ON2C=NCC2)c1.
What is the InChIKey of 4,5-dihydroimidazol-1-yl 3-methylbenzoate?
The InChIKey is IGKRQYCWAIWKCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-9-3-2-4-10(7-9)11(14)15-13-6-5-12-8-13/h2-4,7-8H,5-6H2,1H3.
What are the key properties of 4,5-dihydroimidazol-1-yl 3-methylbenzoate?
4,5-dihydroimidazol-1-yl 3-methylbenzoate has a molecular weight of 204.23 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroimidazol-1-yl 3-methylbenzoate is sourced from PubChem (CID 67903943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).