About cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane
cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane (PubChem CID 67904024) has the molecular formula C36H39BN2Si
and a molecular weight of 538.62 g/mol. Its IUPAC name is cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane.
Molecular Properties
| Compound Name | cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane |
| PubChem CID | 67904024 |
| Molecular Formula | C36H39BN2Si |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane |
| SMILES | C=CB(c1ccccc1)c1ccccc1.c1ccc([Si](Cn2ccnc2)(c2ccccc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H26N2Si.C14H13B/c1-4-10-20(11-5-1)25(19-24-17-16-23-18-24,21-12-6-2-7-13-21)22-14-8-3-9-15-22;1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h1-2,4-7,10-13,16-18,22H,3,8-9,14-15,19H2;2-12H,1H2 |
| InChIKey | OZNLAWMNAJCBBC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane?
The IUPAC name of cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane (CID 67904024) is cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane.
What is the SMILES notation for cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane?
The canonical SMILES for cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane is C=CB(c1ccccc1)c1ccccc1.c1ccc([Si](Cn2ccnc2)(c2ccccc2)C2CCCCC2)cc1.
What is the InChIKey of cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane?
The InChIKey is OZNLAWMNAJCBBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2Si.C14H13B/c1-4-10-20(11-5-1)25(19-24-17-16-23-18-24,21-12-6-2-7-13-21)22-14-8-3-9-15-22;1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h1-2,4-7,10-13,16-18,22H,3,8-9,14-15,19H2;2-12H,1H2.
What are the key properties of cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane?
cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane has a molecular weight of 538.62 g/mol, XLogP of 6.04, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(imidazol-1-ylmethyl)-diphenylsilane;ethenyl(diphenyl)borane is sourced from PubChem (CID 67904024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).