C52H44N4 — CID 67905120
2,3,5,7-tetrakis(2,4-dimethylphenyl)porphyrin (PubChem CID 67905120) has the molecular formula C52H44N4 and a molecular weight of 724.95 g/mol. Its IUPAC name is 2,3,5,7-tetrakis(2,4-dimethylphenyl)porphyrin.
| Compound Name | 2,3,5,7-tetrakis(2,4-dimethylphenyl)porphyrin |
|---|---|
| PubChem CID | 67905120 |
| Molecular Formula | C52H44N4 |
| Molecular Weight | 724.95 g/mol |
| Exact Mass | 724.36 |
| IUPAC Name | 2,3,5,7-tetrakis(2,4-dimethylphenyl)porphyrin |
| SMILES | Cc1ccc(C2=C/C3=C/C4=N/C(=C\C5=N/C(=C\C6=N/C(=C(/c7ccc(C)cc7C)C2=N3)C(c2ccc(C)cc2C)=C6c2ccc(C)cc2C)C=C5)C=C4)c(C)c1 |
| InChI | InChI=1S/C52H44N4/c1-29-9-17-42(33(5)21-29)46-27-41-26-39-14-13-37(53-39)25-38-15-16-40(54-38)28-47-48(43-18-10-30(2)22-34(43)6)49(44-19-11-31(3)23-35(44)7)52(56-47)50(51(46)55-41)45-20-12-32(4)24-36(45)8/h9-28H,1-8H3/b37-25-,38-25-,39-26-,40-28-,41-26-,47-28-,51-50-,52-50- |
| InChIKey | TXKSTTOUEPATEV-WHFIEZHASA-N |
| XLogP | 12.16 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.95 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|