C44H24F4N4 — CID 67905133
2,3,5,7-tetrakis(2-fluorophenyl)porphyrin (PubChem CID 67905133) has the molecular formula C44H24F4N4 and a molecular weight of 684.70 g/mol. Its IUPAC name is 2,3,5,7-tetrakis(2-fluorophenyl)porphyrin.
| Compound Name | 2,3,5,7-tetrakis(2-fluorophenyl)porphyrin |
|---|---|
| PubChem CID | 67905133 |
| Molecular Formula | C44H24F4N4 |
| Molecular Weight | 684.70 g/mol |
| Exact Mass | 684.19 |
| IUPAC Name | 2,3,5,7-tetrakis(2-fluorophenyl)porphyrin |
| SMILES | Fc1ccccc1C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C(/c6ccccc6F)C1=N2)C(c1ccccc1F)=C5c1ccccc1F)C=C4)C=C3 |
| InChI | InChI=1S/C44H24F4N4/c45-35-13-5-1-9-30(35)34-23-29-22-27-18-17-25(49-27)21-26-19-20-28(50-26)24-39-40(31-10-2-6-14-36(31)46)41(32-11-3-7-15-37(32)47)44(52-39)42(43(34)51-29)33-12-4-8-16-38(33)48/h1-24H/b25-21-,26-21-,27-22-,28-24-,29-22-,39-24-,43-42-,44-42- |
| InChIKey | TZCXHYWJWXTVLO-TZMYDMJGSA-N |
| XLogP | 10.24 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.70 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|