C13H15F2N7O5S — CID 67905409
2-amino-1-[2-(difluoromethoxy)phenyl]sulfonyl-1-(4,6-dimethoxy-1,3,5-triazin-2-yl)guanidine (PubChem CID 67905409) has the molecular formula C13H15F2N7O5S and a molecular weight of 419.37 g/mol. Its IUPAC name is 2-amino-1-[2-(difluoromethoxy)phenyl]sulfonyl-1-(4,6-dimethoxy-1,3,5-triazin-2-yl)guanidine.
| Compound Name | 2-amino-1-[2-(difluoromethoxy)phenyl]sulfonyl-1-(4,6-dimethoxy-1,3,5-triazin-2-yl)guanidine |
|---|---|
| PubChem CID | 67905409 |
| Molecular Formula | C13H15F2N7O5S |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 2-amino-1-[2-(difluoromethoxy)phenyl]sulfonyl-1-(4,6-dimethoxy-1,3,5-triazin-2-yl)guanidine |
| SMILES | COc1nc(OC)nc(N(C(N)=NN)S(=O)(=O)c2ccccc2OC(F)F)n1 |
| InChI | InChI=1S/C13H15F2N7O5S/c1-25-12-18-11(19-13(20-12)26-2)22(10(16)21-17)28(23,24)8-6-4-3-5-7(8)27-9(14)15/h3-6,9H,17H2,1-2H3,(H2,16,21) |
| InChIKey | YSHWMMBXODOEOZ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 168.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|