C22H28N2O8 — CID 67905483
ethyl 2-[[4-(3,4-dimethoxyphenyl)-3-(3-ethoxy-3-oxopropyl)-2,5-dioxoimidazolidin-1-yl]methyl]prop-2-enoate (PubChem CID 67905483) has the molecular formula C22H28N2O8 and a molecular weight of 448.47 g/mol. Its IUPAC name is ethyl 2-[[4-(3,4-dimethoxyphenyl)-3-(3-ethoxy-3-oxopropyl)-2,5-dioxoimidazolidin-1-yl]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[4-(3,4-dimethoxyphenyl)-3-(3-ethoxy-3-oxopropyl)-2,5-dioxoimidazolidin-1-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 67905483 |
| Molecular Formula | C22H28N2O8 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | ethyl 2-[[4-(3,4-dimethoxyphenyl)-3-(3-ethoxy-3-oxopropyl)-2,5-dioxoimidazolidin-1-yl]methyl]prop-2-enoate |
| SMILES | C=C(CN1C(=O)C(c2ccc(OC)c(OC)c2)N(CCC(=O)OCC)C1=O)C(=O)OCC |
| InChI | InChI=1S/C22H28N2O8/c1-6-31-18(25)10-11-23-19(15-8-9-16(29-4)17(12-15)30-5)20(26)24(22(23)28)13-14(3)21(27)32-7-2/h8-9,12,19H,3,6-7,10-11,13H2,1-2,4-5H3 |
| InChIKey | MWDZJSGKOMQZFD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|