About 1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate
1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate (PubChem CID 67905585) has the molecular formula C19H23NO6
and a molecular weight of 361.39 g/mol. Its IUPAC name is 1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate.
Molecular Properties
| Compound Name | 1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate |
| PubChem CID | 67905585 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate |
| SMILES | O.O=C(O)C(=O)O.c1ccc(CN2CCC2COc2ccccc2)cc1 |
| InChI | InChI=1S/C17H19NO.C2H2O4.H2O/c1-3-7-15(8-4-1)13-18-12-11-16(18)14-19-17-9-5-2-6-10-17;3-1(4)2(5)6;/h1-10,16H,11-14H2;(H,3,4)(H,5,6);1H2 |
| InChIKey | IQODTRMNKRSXKK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate?
The IUPAC name of 1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate (CID 67905585) is 1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate.
What is the SMILES notation for 1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate?
The canonical SMILES for 1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate is O.O=C(O)C(=O)O.c1ccc(CN2CCC2COc2ccccc2)cc1.
What is the InChIKey of 1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate?
The InChIKey is IQODTRMNKRSXKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO.C2H2O4.H2O/c1-3-7-15(8-4-1)13-18-12-11-16(18)14-19-17-9-5-2-6-10-17;3-1(4)2(5)6;/h1-10,16H,11-14H2;(H,3,4)(H,5,6);1H2.
What are the key properties of 1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate?
1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate has a molecular weight of 361.39 g/mol, XLogP of 1.67, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-(phenoxymethyl)azetidine;oxalic acid;hydrate is sourced from PubChem (CID 67905585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).