About 1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide
1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide (PubChem CID 67905792) has the molecular formula C10H26Br3N5
and a molecular weight of 456.07 g/mol. Its IUPAC name is 1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide.
Molecular Properties
| Compound Name | 1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide |
| PubChem CID | 67905792 |
| Molecular Formula | C10H26Br3N5 |
| Molecular Weight | 456.07 g/mol |
| Exact Mass | 452.97 |
| IUPAC Name | 1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide |
| SMILES | Br.Br.Br.[H]/N=C(\N)N(N)CCCN1CCC(C)CC1 |
| InChI | InChI=1S/C10H23N5.3BrH/c1-9-3-7-14(8-4-9)5-2-6-15(13)10(11)12;;;/h9H,2-8,13H2,1H3,(H3,11,12);3*1H |
| InChIKey | MSZWCDWCPUBOPM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.07 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide?
The IUPAC name of 1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide (CID 67905792) is 1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide.
What is the SMILES notation for 1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide?
The canonical SMILES for 1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide is Br.Br.Br.[H]/N=C(\N)N(N)CCCN1CCC(C)CC1.
What is the InChIKey of 1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide?
The InChIKey is MSZWCDWCPUBOPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N5.3BrH/c1-9-3-7-14(8-4-9)5-2-6-15(13)10(11)12;;;/h9H,2-8,13H2,1H3,(H3,11,12);3*1H.
What are the key properties of 1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide?
1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide has a molecular weight of 456.07 g/mol, XLogP of 1.91, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-1-[3-(4-methylpiperidin-1-yl)propyl]guanidine;trihydrobromide is sourced from PubChem (CID 67905792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).