C16H28O4 — CID 67905836
(2R,3S)-2-(hydroxymethyl)-6-(5-methyl-2-propan-2-ylcyclohexyl)oxy-3,6-dihydro-2H-pyran-3-ol (PubChem CID 67905836) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2R,3S)-2-(hydroxymethyl)-6-(5-methyl-2-propan-2-ylcyclohexyl)oxy-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3S)-2-(hydroxymethyl)-6-(5-methyl-2-propan-2-ylcyclohexyl)oxy-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 67905836 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (2R,3S)-2-(hydroxymethyl)-6-(5-methyl-2-propan-2-ylcyclohexyl)oxy-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CC1CCC(C(C)C)C(OC2C=C[C@H](O)[C@@H](CO)O2)C1 |
| InChI | InChI=1S/C16H28O4/c1-10(2)12-5-4-11(3)8-14(12)19-16-7-6-13(18)15(9-17)20-16/h6-7,10-18H,4-5,8-9H2,1-3H3/t11?,12?,13-,14?,15+,16?/m0/s1 |
| InChIKey | XLEJTMQAXLHJMY-UFYHYMMDSA-N |
| XLogP | 2.10 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|