C37H47N7O3 — CID 67905874
(2S)-N-[(1S)-1-[(2S,4R)-4-butyl-5-oxooxolan-2-yl]-2-cyclohexylethyl]-2-(8-propyl-6-pyridin-3-yl-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-3-pyridin-3-ylpropanamide (PubChem CID 67905874) has the molecular formula C37H47N7O3 and a molecular weight of 637.83 g/mol. Its IUPAC name is (2S)-N-[(1S)-1-[(2S,4R)-4-butyl-5-oxooxolan-2-yl]-2-cyclohexylethyl]-2-(8-propyl-6-pyridin-3-yl-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-3-pyridin-3-ylpropanamide.
| Compound Name | (2S)-N-[(1S)-1-[(2S,4R)-4-butyl-5-oxooxolan-2-yl]-2-cyclohexylethyl]-2-(8-propyl-6-pyridin-3-yl-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 67905874 |
| Molecular Formula | C37H47N7O3 |
| Molecular Weight | 637.83 g/mol |
| Exact Mass | 637.37 |
| IUPAC Name | (2S)-N-[(1S)-1-[(2S,4R)-4-butyl-5-oxooxolan-2-yl]-2-cyclohexylethyl]-2-(8-propyl-6-pyridin-3-yl-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-3-pyridin-3-ylpropanamide |
| SMILES | CCCC[C@@H]1C[C@@H]([C@H](CC2CCCCC2)NC(=O)[C@@H](Cc2cccnc2)c2nnc3c(CCC)nc(-c4cccnc4)cn23)OC1=O |
| InChI | InChI=1S/C37H47N7O3/c1-3-5-15-27-21-33(47-37(27)46)31(20-25-12-7-6-8-13-25)41-36(45)29(19-26-14-9-17-38-22-26)34-42-43-35-30(11-4-2)40-32(24-44(34)35)28-16-10-18-39-23-28/h9-10,14,16-18,22-25,27,29,31,33H,3-8,11-13,15,19-21H2,1-2H3,(H,41,45)/t27-,29+,31+,33+/m1/s1 |
| InChIKey | KOCVPJQGCVHCTF-ARAQASQYSA-N |
| XLogP | 6.44 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.83 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |