C29H34F2N2O5 — CID 67905894
4-[(3R)-3-[bis[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]butyl]benzamide (PubChem CID 67905894) has the molecular formula C29H34F2N2O5 and a molecular weight of 528.60 g/mol. Its IUPAC name is 4-[(3R)-3-[bis[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]butyl]benzamide.
| Compound Name | 4-[(3R)-3-[bis[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]butyl]benzamide |
|---|---|
| PubChem CID | 67905894 |
| Molecular Formula | C29H34F2N2O5 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 4-[(3R)-3-[bis[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]butyl]benzamide |
| SMILES | C[C@H](CCc1ccc(C(N)=O)cc1)N(CC(O)COc1ccccc1F)CC(O)COc1ccccc1F |
| InChI | InChI=1S/C29H34F2N2O5/c1-20(10-11-21-12-14-22(15-13-21)29(32)36)33(16-23(34)18-37-27-8-4-2-6-25(27)30)17-24(35)19-38-28-9-5-3-7-26(28)31/h2-9,12-15,20,23-24,34-35H,10-11,16-19H2,1H3,(H2,32,36)/t20-,23?,24?/m1/s1 |
| InChIKey | SNKCXCDFSFASFA-QUVATAORSA-N |
| XLogP | 3.57 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |