About [2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene
[2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene (PubChem CID 67906404) has the molecular formula C10H8Cl2FN3S
and a molecular weight of 292.17 g/mol. Its IUPAC name is [2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene.
Molecular Properties
| Compound Name | [2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene |
| PubChem CID | 67906404 |
| Molecular Formula | C10H8Cl2FN3S |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | [2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene |
| SMILES | Fc1cccc(/N=N/C2=NCCS2)c1C(Cl)Cl |
| InChI | InChI=1S/C10H8Cl2FN3S/c11-9(12)8-6(13)2-1-3-7(8)15-16-10-14-4-5-17-10/h1-3,9H,4-5H2/b16-15+ |
| InChIKey | IMVIQOCKKYDIIO-FOCLMDBBSA-N |
| XLogP | 4.49 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene?
The IUPAC name of [2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene (CID 67906404) is [2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene.
What is the SMILES notation for [2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene?
The canonical SMILES for [2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene is Fc1cccc(/N=N/C2=NCCS2)c1C(Cl)Cl.
What is the InChIKey of [2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene?
The InChIKey is IMVIQOCKKYDIIO-FOCLMDBBSA-N. The full InChI is InChI=1S/C10H8Cl2FN3S/c11-9(12)8-6(13)2-1-3-7(8)15-16-10-14-4-5-17-10/h1-3,9H,4-5H2/b16-15+.
What are the key properties of [2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene?
[2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene has a molecular weight of 292.17 g/mol, XLogP of 4.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dichloromethyl)-3-fluorophenyl]-(4,5-dihydro-1,3-thiazol-2-yl)diazene is sourced from PubChem (CID 67906404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).