C22H26N2OS — CID 67906498
N-[2-[4-[(5R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]phenyl]sulfanylphenyl]acetamide (PubChem CID 67906498) has the molecular formula C22H26N2OS and a molecular weight of 366.53 g/mol. Its IUPAC name is N-[2-[4-[(5R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]phenyl]sulfanylphenyl]acetamide.
| Compound Name | N-[2-[4-[(5R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]phenyl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 67906498 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N-[2-[4-[(5R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]phenyl]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1Sc1ccc([C@H]2CCC[C@@H]3CCCN32)cc1 |
| InChI | InChI=1S/C22H26N2OS/c1-16(25)23-20-8-2-3-10-22(20)26-19-13-11-17(12-14-19)21-9-4-6-18-7-5-15-24(18)21/h2-3,8,10-14,18,21H,4-7,9,15H2,1H3,(H,23,25)/t18-,21-/m1/s1 |
| InChIKey | CHZLYZYILFXOQR-WIYYLYMNSA-N |
| XLogP | 5.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |