About 11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate
11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate (PubChem CID 67906965) has the molecular formula C23H15BrN2O2
and a molecular weight of 431.29 g/mol. Its IUPAC name is 11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate.
Molecular Properties
| Compound Name | 11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate |
| PubChem CID | 67906965 |
| Molecular Formula | C23H15BrN2O2 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate |
| SMILES | Nc1ccc(Br)c(C(=O)Oc2ccc3ccc4c5ccccc5[nH]c4c3c2)c1 |
| InChI | InChI=1S/C23H15BrN2O2/c24-20-10-7-14(25)11-19(20)23(27)28-15-8-5-13-6-9-17-16-3-1-2-4-21(16)26-22(17)18(13)12-15/h1-12,26H,25H2 |
| InChIKey | ARLUDSVYLPFGBL-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate?
The IUPAC name of 11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate (CID 67906965) is 11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate.
What is the SMILES notation for 11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate?
The canonical SMILES for 11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate is Nc1ccc(Br)c(C(=O)Oc2ccc3ccc4c5ccccc5[nH]c4c3c2)c1.
What is the InChIKey of 11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate?
The InChIKey is ARLUDSVYLPFGBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15BrN2O2/c24-20-10-7-14(25)11-19(20)23(27)28-15-8-5-13-6-9-17-16-3-1-2-4-21(16)26-22(17)18(13)12-15/h1-12,26H,25H2.
What are the key properties of 11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate?
11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate has a molecular weight of 431.29 g/mol, XLogP of 6.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11H-benzo[a]carbazol-2-yl 5-amino-2-bromobenzoate is sourced from PubChem (CID 67906965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).