C31H38O9S2 — CID 67906978
4-[2-[2-methoxy-6-propylsulfonyl-4-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]ethylsulfanyl]phenol (PubChem CID 67906978) has the molecular formula C31H38O9S2 and a molecular weight of 618.77 g/mol. Its IUPAC name is 4-[2-[2-methoxy-6-propylsulfonyl-4-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]ethylsulfanyl]phenol.
| Compound Name | 4-[2-[2-methoxy-6-propylsulfonyl-4-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]ethylsulfanyl]phenol |
|---|---|
| PubChem CID | 67906978 |
| Molecular Formula | C31H38O9S2 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.20 |
| IUPAC Name | 4-[2-[2-methoxy-6-propylsulfonyl-4-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]ethylsulfanyl]phenol |
| SMILES | CCCS(=O)(=O)c1cc([C@H]2CC[C@H](c3cc(OC)c(OC)c(OC)c3)O2)cc(OC)c1OCCSc1ccc(O)cc1 |
| InChI | InChI=1S/C31H38O9S2/c1-6-15-42(33,34)29-19-21(18-28(37-4)31(29)39-13-14-41-23-9-7-22(32)8-10-23)25-12-11-24(40-25)20-16-26(35-2)30(38-5)27(17-20)36-3/h7-10,16-19,24-25,32H,6,11-15H2,1-5H3/t24-,25-/m1/s1 |
| InChIKey | QOTWMYCWPBOUBA-JWQCQUIFSA-N |
| XLogP | 6.37 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|