C18H34O2Si — CID 67907260
(3R)-3-methyl-5-(2,6,6-trimethyl-4-trimethylsilyloxycyclohexen-1-yl)pent-1-en-3-ol (PubChem CID 67907260) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is (3R)-3-methyl-5-(2,6,6-trimethyl-4-trimethylsilyloxycyclohexen-1-yl)pent-1-en-3-ol.
| Compound Name | (3R)-3-methyl-5-(2,6,6-trimethyl-4-trimethylsilyloxycyclohexen-1-yl)pent-1-en-3-ol |
|---|---|
| PubChem CID | 67907260 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (3R)-3-methyl-5-(2,6,6-trimethyl-4-trimethylsilyloxycyclohexen-1-yl)pent-1-en-3-ol |
| SMILES | C=C[C@](C)(O)CCC1=C(C)CC(O[Si](C)(C)C)CC1(C)C |
| InChI | InChI=1S/C18H34O2Si/c1-9-18(5,19)11-10-16-14(2)12-15(13-17(16,3)4)20-21(6,7)8/h9,15,19H,1,10-13H2,2-8H3/t15?,18-/m0/s1 |
| InChIKey | SLDCFIAUFSRLDG-PKHIMPSTSA-N |
| XLogP | 5.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|