About 5-(bromomethyl)-1,4-dichloronaphthalene
5-(bromomethyl)-1,4-dichloronaphthalene (PubChem CID 67907571) has the molecular formula C11H7BrCl2
and a molecular weight of 289.99 g/mol. Its IUPAC name is 5-(bromomethyl)-1,4-dichloronaphthalene.
Molecular Properties
| Compound Name | 5-(bromomethyl)-1,4-dichloronaphthalene |
| PubChem CID | 67907571 |
| Molecular Formula | C11H7BrCl2 |
| Molecular Weight | 289.99 g/mol |
| Exact Mass | 287.91 |
| IUPAC Name | 5-(bromomethyl)-1,4-dichloronaphthalene |
| SMILES | Clc1ccc(Cl)c2c(CBr)cccc12 |
| InChI | InChI=1S/C11H7BrCl2/c12-6-7-2-1-3-8-9(13)4-5-10(14)11(7)8/h1-5H,6H2 |
| InChIKey | NDUCXBXEGBQGFC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.99 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromomethyl)-1,4-dichloronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromomethyl)-1,4-dichloronaphthalene?
The IUPAC name of 5-(bromomethyl)-1,4-dichloronaphthalene (CID 67907571) is 5-(bromomethyl)-1,4-dichloronaphthalene.
What is the SMILES notation for 5-(bromomethyl)-1,4-dichloronaphthalene?
The canonical SMILES for 5-(bromomethyl)-1,4-dichloronaphthalene is Clc1ccc(Cl)c2c(CBr)cccc12.
What is the InChIKey of 5-(bromomethyl)-1,4-dichloronaphthalene?
The InChIKey is NDUCXBXEGBQGFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrCl2/c12-6-7-2-1-3-8-9(13)4-5-10(14)11(7)8/h1-5H,6H2.
What are the key properties of 5-(bromomethyl)-1,4-dichloronaphthalene?
5-(bromomethyl)-1,4-dichloronaphthalene has a molecular weight of 289.99 g/mol, XLogP of 5.04, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromomethyl)-1,4-dichloronaphthalene is sourced from PubChem (CID 67907571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).