7-oxo-8H-1,8-naphthyridine-2-carboxylic acid

C9H6N2O3 — CID 67907967

IUPAC7-oxo-8H-1,8-naphthyridine-2-carboxylic acid
SMILESO=C(O)c1ccc2ccc(=O)[nH]c2n1
InChIInChI=1S/C9H6N2O3/c12-7-4-2-5-1-3-6(9(13)14)10-8(5)11-7/h1-4H,(H,13,14)(H,10,11,12)
InChIKeyWIEBWJLPLVAEJI-UHFFFAOYSA-N
MW190.16 g/mol
LogP0.62
Rot. Bonds1

About 7-oxo-8H-1,8-naphthyridine-2-carboxylic acid

7-oxo-8H-1,8-naphthyridine-2-carboxylic acid (PubChem CID 67907967) has the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. Its IUPAC name is 7-oxo-8H-1,8-naphthyridine-2-carboxylic acid.

Molecular Properties

Compound Name7-oxo-8H-1,8-naphthyridine-2-carboxylic acid
PubChem CID67907967
Molecular FormulaC9H6N2O3
Molecular Weight190.16 g/mol
Exact Mass190.04
IUPAC Name7-oxo-8H-1,8-naphthyridine-2-carboxylic acid
SMILESO=C(O)c1ccc2ccc(=O)[nH]c2n1
InChIInChI=1S/C9H6N2O3/c12-7-4-2-5-1-3-6(9(13)14)10-8(5)11-7/h1-4H,(H,13,14)(H,10,11,12)
InChIKeyWIEBWJLPLVAEJI-UHFFFAOYSA-N
XLogP0.62
TPSA83.05 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.16
LogP ≤ 50.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 7-oxo-8H-1,8-naphthyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-oxo-8H-1,8-naphthyridine-2-carboxylic acid?
The IUPAC name of 7-oxo-8H-1,8-naphthyridine-2-carboxylic acid (CID 67907967) is 7-oxo-8H-1,8-naphthyridine-2-carboxylic acid.
What is the SMILES notation for 7-oxo-8H-1,8-naphthyridine-2-carboxylic acid?
The canonical SMILES for 7-oxo-8H-1,8-naphthyridine-2-carboxylic acid is O=C(O)c1ccc2ccc(=O)[nH]c2n1.
What is the InChIKey of 7-oxo-8H-1,8-naphthyridine-2-carboxylic acid?
The InChIKey is WIEBWJLPLVAEJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3/c12-7-4-2-5-1-3-6(9(13)14)10-8(5)11-7/h1-4H,(H,13,14)(H,10,11,12).
What are the key properties of 7-oxo-8H-1,8-naphthyridine-2-carboxylic acid?
7-oxo-8H-1,8-naphthyridine-2-carboxylic acid has a molecular weight of 190.16 g/mol, XLogP of 0.62, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxo-8H-1,8-naphthyridine-2-carboxylic acid is sourced from PubChem (CID 67907967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).