C24H32FNO5P+ — CID 67908058
[(2S)-3-carboxy-2-hydroxypropyl]-[3-[3-(4-fluorophenyl)-1-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]propoxy]-oxophosphanium (PubChem CID 67908058) has the molecular formula C24H32FNO5P+ and a molecular weight of 464.49 g/mol. Its IUPAC name is [(2S)-3-carboxy-2-hydroxypropyl]-[3-[3-(4-fluorophenyl)-1-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]propoxy]-oxophosphanium.
| Compound Name | [(2S)-3-carboxy-2-hydroxypropyl]-[3-[3-(4-fluorophenyl)-1-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]propoxy]-oxophosphanium |
|---|---|
| PubChem CID | 67908058 |
| Molecular Formula | C24H32FNO5P+ |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | [(2S)-3-carboxy-2-hydroxypropyl]-[3-[3-(4-fluorophenyl)-1-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]propoxy]-oxophosphanium |
| SMILES | CC(C)c1c(CCCO[P+](=O)C[C@@H](O)CC(=O)O)c(-c2ccc(F)cc2)n2c1CCCC2 |
| InChI | InChI=1S/C24H31FNO5P/c1-16(2)23-20(6-5-13-31-32(30)15-19(27)14-22(28)29)24(17-8-10-18(25)11-9-17)26-12-4-3-7-21(23)26/h8-11,16,19,27H,3-7,12-15H2,1-2H3/p+1/t19-/m0/s1 |
| InChIKey | UAVNQSNEKQJLJU-IBGZPJMESA-O |
| XLogP | 5.28 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|