C24H39FO4 — CID 67908242
(4R)-4-[(5R,8S,9S,10R,13R,14S,17R)-6-fluoro-1,1-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 67908242) has the molecular formula C24H39FO4 and a molecular weight of 410.57 g/mol. Its IUPAC name is (4R)-4-[(5R,8S,9S,10R,13R,14S,17R)-6-fluoro-1,1-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(5R,8S,9S,10R,13R,14S,17R)-6-fluoro-1,1-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 67908242 |
| Molecular Formula | C24H39FO4 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | (4R)-4-[(5R,8S,9S,10R,13R,14S,17R)-6-fluoro-1,1-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@@H]3CC(F)[C@@H]4CCCC(O)(O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H39FO4/c1-14(6-9-21(26)27)16-7-8-17-15-13-20(25)19-5-4-11-24(28,29)23(19,3)18(15)10-12-22(16,17)2/h14-20,28-29H,4-13H2,1-3H3,(H,26,27)/t14-,15+,16-,17+,18+,19+,20?,22-,23-/m1/s1 |
| InChIKey | WPRRVHININLQHI-WTNQARASSA-N |
| XLogP | 4.78 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|