C24H44O8SSi2 — CID 67908664
(2S,3S,4R,6S)-6-(benzenesulfonyl)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 67908664) has the molecular formula C24H44O8SSi2 and a molecular weight of 548.85 g/mol. Its IUPAC name is (2S,3S,4R,6S)-6-(benzenesulfonyl)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2S,3S,4R,6S)-6-(benzenesulfonyl)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 67908664 |
| Molecular Formula | C24H44O8SSi2 |
| Molecular Weight | 548.85 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | (2S,3S,4R,6S)-6-(benzenesulfonyl)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]1(S(=O)(=O)c2ccccc2)C[C@@](O)(O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](CO)O1 |
| InChI | InChI=1S/C24H44O8SSi2/c1-21(2,3)34(7,8)31-23(27)17-24(30-19(16-25)20(23)26,32-35(9,10)22(4,5)6)33(28,29)18-14-12-11-13-15-18/h11-15,19-20,25-27H,16-17H2,1-10H3/t19-,20-,23+,24-/m0/s1 |
| InChIKey | FJEFOYOFEAWUTR-JVODISISSA-N |
| XLogP | 3.99 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.85 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|