C23H29NO3 — CID 67909345
2-[[(2R,3R,3aS,8bS)-3-[(Z)-3-cyclohexyl-3-hydroxyprop-1-enyl]-2-hydroxy-1,2,3,3a,4,8b-hexahydrocyclopenta[a]inden-8-yl]oxy]acetonitrile (PubChem CID 67909345) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is 2-[[(2R,3R,3aS,8bS)-3-[(Z)-3-cyclohexyl-3-hydroxyprop-1-enyl]-2-hydroxy-1,2,3,3a,4,8b-hexahydrocyclopenta[a]inden-8-yl]oxy]acetonitrile.
| Compound Name | 2-[[(2R,3R,3aS,8bS)-3-[(Z)-3-cyclohexyl-3-hydroxyprop-1-enyl]-2-hydroxy-1,2,3,3a,4,8b-hexahydrocyclopenta[a]inden-8-yl]oxy]acetonitrile |
|---|---|
| PubChem CID | 67909345 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 2-[[(2R,3R,3aS,8bS)-3-[(Z)-3-cyclohexyl-3-hydroxyprop-1-enyl]-2-hydroxy-1,2,3,3a,4,8b-hexahydrocyclopenta[a]inden-8-yl]oxy]acetonitrile |
| SMILES | N#CCOc1cccc2c1[C@H]1C[C@@H](O)[C@H](/C=C\C(O)C3CCCCC3)[C@H]1C2 |
| InChI | InChI=1S/C23H29NO3/c24-11-12-27-22-8-4-7-16-13-18-17(21(26)14-19(18)23(16)22)9-10-20(25)15-5-2-1-3-6-15/h4,7-10,15,17-21,25-26H,1-3,5-6,12-14H2/b10-9-/t17-,18-,19+,20?,21-/m1/s1 |
| InChIKey | INQUAFUHYNJTJO-VVYDUGGFSA-N |
| XLogP | 3.72 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|