C24H40O3 — CID 67909359
(5Z)-1-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-5-(5-hydroxy-3,3-dimethylpentylidene)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol (PubChem CID 67909359) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is (5Z)-1-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-5-(5-hydroxy-3,3-dimethylpentylidene)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol.
| Compound Name | (5Z)-1-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-5-(5-hydroxy-3,3-dimethylpentylidene)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol |
|---|---|
| PubChem CID | 67909359 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | (5Z)-1-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-5-(5-hydroxy-3,3-dimethylpentylidene)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol |
| SMILES | CC(C)(C/C=C1/CC2CC(O)C(/C=C/C(O)C3CCCCC3)C2C1)CCO |
| InChI | InChI=1S/C24H40O3/c1-24(2,12-13-25)11-10-17-14-19-16-23(27)20(21(19)15-17)8-9-22(26)18-6-4-3-5-7-18/h8-10,18-23,25-27H,3-7,11-16H2,1-2H3/b9-8+,17-10- |
| InChIKey | RSDSTTBUGIKPNY-OAXSMGAZSA-N |
| XLogP | 4.62 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|