About 3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole
3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole (PubChem CID 67909937) has the molecular formula C27H32N2
and a molecular weight of 384.57 g/mol. Its IUPAC name is 3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole.
Molecular Properties
| Compound Name | 3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole |
| PubChem CID | 67909937 |
| Molecular Formula | C27H32N2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole |
| SMILES | C1=CCC(C2=CCN(CCC3CCC(c4c[nH]c5ccccc45)CC3)C=C2)=CC1 |
| InChI | InChI=1S/C27H32N2/c1-2-6-22(7-3-1)23-15-18-29(19-16-23)17-14-21-10-12-24(13-11-21)26-20-28-27-9-5-4-8-25(26)27/h1-2,4-5,7-9,15-16,18,20-21,24,28H,3,6,10-14,17,19H2 |
| InChIKey | NWZNEJBEKRUXEJ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole?
The IUPAC name of 3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole (CID 67909937) is 3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole.
What is the SMILES notation for 3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole?
The canonical SMILES for 3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole is C1=CCC(C2=CCN(CCC3CCC(c4c[nH]c5ccccc45)CC3)C=C2)=CC1.
What is the InChIKey of 3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole?
The InChIKey is NWZNEJBEKRUXEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H32N2/c1-2-6-22(7-3-1)23-15-18-29(19-16-23)17-14-21-10-12-24(13-11-21)26-20-28-27-9-5-4-8-25(26)27/h1-2,4-5,7-9,15-16,18,20-21,24,28H,3,6,10-14,17,19H2.
What are the key properties of 3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole?
3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole has a molecular weight of 384.57 g/mol, XLogP of 6.86, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[2-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)ethyl]cyclohexyl]-1H-indole is sourced from PubChem (CID 67909937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).