C30H36N4O4S — CID 67910085
2-[4-[[2-butyl-5-(hexylsulfonylamino)imidazo[4,5-b]pyridin-3-yl]methyl]phenyl]benzoic acid (PubChem CID 67910085) has the molecular formula C30H36N4O4S and a molecular weight of 548.71 g/mol. Its IUPAC name is 2-[4-[[2-butyl-5-(hexylsulfonylamino)imidazo[4,5-b]pyridin-3-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2-butyl-5-(hexylsulfonylamino)imidazo[4,5-b]pyridin-3-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 67910085 |
| Molecular Formula | C30H36N4O4S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 2-[4-[[2-butyl-5-(hexylsulfonylamino)imidazo[4,5-b]pyridin-3-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCCCS(=O)(=O)Nc1ccc2nc(CCCC)n(Cc3ccc(-c4ccccc4C(=O)O)cc3)c2n1 |
| InChI | InChI=1S/C30H36N4O4S/c1-3-5-7-10-20-39(37,38)33-27-19-18-26-29(32-27)34(28(31-26)13-6-4-2)21-22-14-16-23(17-15-22)24-11-8-9-12-25(24)30(35)36/h8-9,11-12,14-19H,3-7,10,13,20-21H2,1-2H3,(H,32,33)(H,35,36) |
| InChIKey | AKNDGWULBNDYFF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|