About N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide
N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide (PubChem CID 67910334) has the molecular formula C15H9F2N3O4S
and a molecular weight of 365.32 g/mol. Its IUPAC name is N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide.
Molecular Properties
| Compound Name | N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide |
| PubChem CID | 67910334 |
| Molecular Formula | C15H9F2N3O4S |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1)c1nc2cc(F)c(F)cc2[nH]c1=O |
| InChI | InChI=1S/C15H9F2N3O4S/c16-9-6-11-12(7-10(9)17)19-14(21)13(18-11)15(22)20-25(23,24)8-4-2-1-3-5-8/h1-7H,(H,19,21)(H,20,22) |
| InChIKey | HZBASXHPONJEBK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide?
The IUPAC name of N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide (CID 67910334) is N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide.
What is the SMILES notation for N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide?
The canonical SMILES for N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide is O=C(NS(=O)(=O)c1ccccc1)c1nc2cc(F)c(F)cc2[nH]c1=O.
What is the InChIKey of N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide?
The InChIKey is HZBASXHPONJEBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F2N3O4S/c16-9-6-11-12(7-10(9)17)19-14(21)13(18-11)15(22)20-25(23,24)8-4-2-1-3-5-8/h1-7H,(H,19,21)(H,20,22).
What are the key properties of N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide?
N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide has a molecular weight of 365.32 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(benzenesulfonyl)-6,7-difluoro-3-oxo-4H-quinoxaline-2-carboxamide is sourced from PubChem (CID 67910334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).