C16H12O4 — CID 67910781
7,10-dioxatricyclo[10.2.2.22,5]octadeca-1(15),2(18),3,5(17),12(16),13-hexaene-6,11-dione (PubChem CID 67910781) has the molecular formula C16H12O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 7,10-dioxatricyclo[10.2.2.22,5]octadeca-1(15),2(18),3,5(17),12(16),13-hexaene-6,11-dione.
| Compound Name | 7,10-dioxatricyclo[10.2.2.22,5]octadeca-1(15),2(18),3,5(17),12(16),13-hexaene-6,11-dione |
|---|---|
| PubChem CID | 67910781 |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 7,10-dioxatricyclo[10.2.2.22,5]octadeca-1(15),2(18),3,5(17),12(16),13-hexaene-6,11-dione |
| SMILES | O=C1OCCOC(=O)c2ccc(cc2)-c2ccc1cc2 |
| InChI | InChI=1S/C16H12O4/c17-15-13-5-1-11(2-6-13)12-3-7-14(8-4-12)16(18)20-10-9-19-15/h1-8H,9-10H2 |
| InChIKey | FOTLBBZESRYMDV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |