C16H17NO3 — CID 67911037
4-methoxy-15-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,5-triene-8,16-dione (PubChem CID 67911037) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-methoxy-15-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,5-triene-8,16-dione.
| Compound Name | 4-methoxy-15-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,5-triene-8,16-dione |
|---|---|
| PubChem CID | 67911037 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-methoxy-15-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,5-triene-8,16-dione |
| SMILES | COc1ccc2c(c1)C13CCCCC1C(C(=O)N3)C2=O |
| InChI | InChI=1S/C16H17NO3/c1-20-9-5-6-10-12(8-9)16-7-3-2-4-11(16)13(14(10)18)15(19)17-16/h5-6,8,11,13H,2-4,7H2,1H3,(H,17,19) |
| InChIKey | PCSQOJVASZSKIQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|