C17H20O5 — CID 67911104
6-methoxy-2,3,4,9,10,10a-hexahydro-1H-phenanthrene-4a,9-dicarboxylic acid (PubChem CID 67911104) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is 6-methoxy-2,3,4,9,10,10a-hexahydro-1H-phenanthrene-4a,9-dicarboxylic acid.
| Compound Name | 6-methoxy-2,3,4,9,10,10a-hexahydro-1H-phenanthrene-4a,9-dicarboxylic acid |
|---|---|
| PubChem CID | 67911104 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 6-methoxy-2,3,4,9,10,10a-hexahydro-1H-phenanthrene-4a,9-dicarboxylic acid |
| SMILES | COc1ccc2c(c1)C1(C(=O)O)CCCCC1CC2C(=O)O |
| InChI | InChI=1S/C17H20O5/c1-22-11-5-6-12-13(15(18)19)8-10-4-2-3-7-17(10,16(20)21)14(12)9-11/h5-6,9-10,13H,2-4,7-8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | UAPNRNPVBSKWGL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |