C26H29BrN2O4 — CID 6791254
1-(4-bromo-3-methylphenyl)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 6791254) has the molecular formula C26H29BrN2O4 and a molecular weight of 513.43 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(4-bromo-3-methylphenyl)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6791254 |
| Molecular Formula | C26H29BrN2O4 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1cc(N2C(=O)NC(=O)C(=Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)C2=O)ccc1Br |
| InChI | InChI=1S/C26H29BrN2O4/c1-14-10-16(8-9-20(14)27)29-23(32)17(22(31)28-24(29)33)11-15-12-18(25(2,3)4)21(30)19(13-15)26(5,6)7/h8-13,30H,1-7H3,(H,28,31,33) |
| InChIKey | BDOXNEXLOPPNJA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|