C30H37N3O2Si — CID 67912676
3-[tert-butyl(dimethyl)silyl]oxy-3-(2-trityl-1,2,4-triazol-3-yl)propan-1-ol (PubChem CID 67912676) has the molecular formula C30H37N3O2Si and a molecular weight of 499.73 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-3-(2-trityl-1,2,4-triazol-3-yl)propan-1-ol.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-3-(2-trityl-1,2,4-triazol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 67912676 |
| Molecular Formula | C30H37N3O2Si |
| Molecular Weight | 499.73 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-3-(2-trityl-1,2,4-triazol-3-yl)propan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCO)c1ncnn1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H37N3O2Si/c1-29(2,3)36(4,5)35-27(21-22-34)28-31-23-32-33(28)30(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,23,27,34H,21-22H2,1-5H3 |
| InChIKey | OSTJULZYQAITQS-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.73 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|