C19H24F2O2 — CID 67912775
(1S,3S,9R,11R)-11-[(2,6-difluorophenyl)methoxy]-1-methyl-2-oxatricyclo[6.3.1.03,9]dodecane (PubChem CID 67912775) has the molecular formula C19H24F2O2 and a molecular weight of 322.39 g/mol. Its IUPAC name is (1S,3S,9R,11R)-11-[(2,6-difluorophenyl)methoxy]-1-methyl-2-oxatricyclo[6.3.1.03,9]dodecane.
| Compound Name | (1S,3S,9R,11R)-11-[(2,6-difluorophenyl)methoxy]-1-methyl-2-oxatricyclo[6.3.1.03,9]dodecane |
|---|---|
| PubChem CID | 67912775 |
| Molecular Formula | C19H24F2O2 |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (1S,3S,9R,11R)-11-[(2,6-difluorophenyl)methoxy]-1-methyl-2-oxatricyclo[6.3.1.03,9]dodecane |
| SMILES | C[C@@]12CC3CCCC[C@H](O1)[C@@H]3C[C@H]2OCc1c(F)cccc1F |
| InChI | InChI=1S/C19H24F2O2/c1-19-10-12-5-2-3-8-17(23-19)13(12)9-18(19)22-11-14-15(20)6-4-7-16(14)21/h4,6-7,12-13,17-18H,2-3,5,8-11H2,1H3/t12?,13-,17+,18-,19+/m1/s1 |
| InChIKey | NFSDBZVGXHJYLS-LIIHUSMHSA-N |
| XLogP | 4.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |