C11H19NS — CID 67912947
2-methylsulfanyl-2,3,4,5,5a,8,9,9a-octahydro-1H-1-benzazepine (PubChem CID 67912947) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is 2-methylsulfanyl-2,3,4,5,5a,8,9,9a-octahydro-1H-1-benzazepine.
| Compound Name | 2-methylsulfanyl-2,3,4,5,5a,8,9,9a-octahydro-1H-1-benzazepine |
|---|---|
| PubChem CID | 67912947 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-methylsulfanyl-2,3,4,5,5a,8,9,9a-octahydro-1H-1-benzazepine |
| SMILES | CSC1CCCC2C=CCCC2N1 |
| InChI | InChI=1S/C11H19NS/c1-13-11-8-4-6-9-5-2-3-7-10(9)12-11/h2,5,9-12H,3-4,6-8H2,1H3 |
| InChIKey | FOEDQKNOJOSKPD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|