C11H21NS — CID 67912948
2-methylsulfanyl-2,3,4,5,5a,6,7,8,9,9a-decahydro-1H-benzo[b]azepine (PubChem CID 67912948) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is 2-methylsulfanyl-2,3,4,5,5a,6,7,8,9,9a-decahydro-1H-benzo[b]azepine.
| Compound Name | 2-methylsulfanyl-2,3,4,5,5a,6,7,8,9,9a-decahydro-1H-benzo[b]azepine |
|---|---|
| PubChem CID | 67912948 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 2-methylsulfanyl-2,3,4,5,5a,6,7,8,9,9a-decahydro-1H-benzo[b]azepine |
| SMILES | CSC1CCCC2CCCCC2N1 |
| InChI | InChI=1S/C11H21NS/c1-13-11-8-4-6-9-5-2-3-7-10(9)12-11/h9-12H,2-8H2,1H3 |
| InChIKey | OTIDNDSDOSDFKD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |