About acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine
acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine (PubChem CID 67913130) has the molecular formula C22H46N2O2
and a molecular weight of 370.62 g/mol. Its IUPAC name is acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine |
| PubChem CID | 67913130 |
| Molecular Formula | C22H46N2O2 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.36 |
| IUPAC Name | acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CC(=O)O.CN(C)CCCNC1CCCCCCCCCCCCCC1 |
| InChI | InChI=1S/C20H42N2.C2H4O2/c1-22(2)19-15-18-21-20-16-13-11-9-7-5-3-4-6-8-10-12-14-17-20;1-2(3)4/h20-21H,3-19H2,1-2H3;1H3,(H,3,4) |
| InChIKey | IPRFAESBCGVYDF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine?
The IUPAC name of acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine (CID 67913130) is acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine.
What is the SMILES notation for acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine?
The canonical SMILES for acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine is CC(=O)O.CN(C)CCCNC1CCCCCCCCCCCCCC1.
What is the InChIKey of acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine?
The InChIKey is IPRFAESBCGVYDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42N2.C2H4O2/c1-22(2)19-15-18-21-20-16-13-11-9-7-5-3-4-6-8-10-12-14-17-20;1-2(3)4/h20-21H,3-19H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine?
acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine has a molecular weight of 370.62 g/mol, XLogP of 5.46, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;N-cyclopentadecyl-N',N'-dimethylpropane-1,3-diamine is sourced from PubChem (CID 67913130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).