C31H43F3O3Si — CID 67913893
tert-butyl-diphenyl-[(2R)-10,10,10-trifluoro-1-(oxan-2-yloxy)dec-4-en-2-yl]oxysilane (PubChem CID 67913893) has the molecular formula C31H43F3O3Si and a molecular weight of 548.76 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(2R)-10,10,10-trifluoro-1-(oxan-2-yloxy)dec-4-en-2-yl]oxysilane.
| Compound Name | tert-butyl-diphenyl-[(2R)-10,10,10-trifluoro-1-(oxan-2-yloxy)dec-4-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 67913893 |
| Molecular Formula | C31H43F3O3Si |
| Molecular Weight | 548.76 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | tert-butyl-diphenyl-[(2R)-10,10,10-trifluoro-1-(oxan-2-yloxy)dec-4-en-2-yl]oxysilane |
| SMILES | CC(C)(C)[Si](O[C@H](CC=CCCCCC(F)(F)F)COC1CCCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H43F3O3Si/c1-30(2,3)38(27-18-10-7-11-19-27,28-20-12-8-13-21-28)37-26(25-36-29-22-14-16-24-35-29)17-9-5-4-6-15-23-31(32,33)34/h5,7-13,18-21,26,29H,4,6,14-17,22-25H2,1-3H3/t26-,29?/m1/s1 |
| InChIKey | JJVRQVXXTUVJGM-QZWVJJBASA-N |
| XLogP | 7.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.76 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|