About 2,5-dihydro-1H-1,7-naphthyridin-6-imine
2,5-dihydro-1H-1,7-naphthyridin-6-imine (PubChem CID 67913999) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 2,5-dihydro-1H-1,7-naphthyridin-6-imine.
Molecular Properties
| Compound Name | 2,5-dihydro-1H-1,7-naphthyridin-6-imine |
| PubChem CID | 67913999 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 2,5-dihydro-1H-1,7-naphthyridin-6-imine |
| SMILES | [H]/N=C1/CC2=C(C=N1)NCC=C2 |
| InChI | InChI=1S/C8H9N3/c9-8-4-6-2-1-3-10-7(6)5-11-8/h1-2,5,9-10H,3-4H2/b9-8- |
| InChIKey | OQFKRIOAJZWORP-HJWRWDBZSA-N |
| XLogP | 0.85 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dihydro-1H-1,7-naphthyridin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dihydro-1H-1,7-naphthyridin-6-imine?
The IUPAC name of 2,5-dihydro-1H-1,7-naphthyridin-6-imine (CID 67913999) is 2,5-dihydro-1H-1,7-naphthyridin-6-imine.
What is the SMILES notation for 2,5-dihydro-1H-1,7-naphthyridin-6-imine?
The canonical SMILES for 2,5-dihydro-1H-1,7-naphthyridin-6-imine is [H]/N=C1/CC2=C(C=N1)NCC=C2.
What is the InChIKey of 2,5-dihydro-1H-1,7-naphthyridin-6-imine?
The InChIKey is OQFKRIOAJZWORP-HJWRWDBZSA-N. The full InChI is InChI=1S/C8H9N3/c9-8-4-6-2-1-3-10-7(6)5-11-8/h1-2,5,9-10H,3-4H2/b9-8-.
What are the key properties of 2,5-dihydro-1H-1,7-naphthyridin-6-imine?
2,5-dihydro-1H-1,7-naphthyridin-6-imine has a molecular weight of 147.18 g/mol, XLogP of 0.85, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydro-1H-1,7-naphthyridin-6-imine is sourced from PubChem (CID 67913999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).