C26H44O9Si — CID 67914212
[(E,2R,3S)-3-acetyloxy-6-(2-butyl-5-oxo-2-trimethylsilyloxycyclopent-3-en-1-yl)-6-hydroxy-2-(2-methoxypropan-2-yloxy)hex-4-enyl] acetate (PubChem CID 67914212) has the molecular formula C26H44O9Si and a molecular weight of 528.72 g/mol. Its IUPAC name is [(E,2R,3S)-3-acetyloxy-6-(2-butyl-5-oxo-2-trimethylsilyloxycyclopent-3-en-1-yl)-6-hydroxy-2-(2-methoxypropan-2-yloxy)hex-4-enyl] acetate.
| Compound Name | [(E,2R,3S)-3-acetyloxy-6-(2-butyl-5-oxo-2-trimethylsilyloxycyclopent-3-en-1-yl)-6-hydroxy-2-(2-methoxypropan-2-yloxy)hex-4-enyl] acetate |
|---|---|
| PubChem CID | 67914212 |
| Molecular Formula | C26H44O9Si |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | [(E,2R,3S)-3-acetyloxy-6-(2-butyl-5-oxo-2-trimethylsilyloxycyclopent-3-en-1-yl)-6-hydroxy-2-(2-methoxypropan-2-yloxy)hex-4-enyl] acetate |
| SMILES | CCCCC1(O[Si](C)(C)C)C=CC(=O)C1C(O)/C=C/[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)(C)OC |
| InChI | InChI=1S/C26H44O9Si/c1-10-11-15-26(35-36(7,8)9)16-14-21(30)24(26)20(29)12-13-22(33-19(3)28)23(17-32-18(2)27)34-25(4,5)31-6/h12-14,16,20,22-24,29H,10-11,15,17H2,1-9H3/b13-12+/t20?,22-,23+,24?,26?/m0/s1 |
| InChIKey | QFCCNMRCKLCJOE-YBKBVUOESA-N |
| XLogP | 3.70 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|