C18H22O4S — CID 67914268
4-(4-hydroxy-4-prop-2-enylcyclohexa-1,5-dien-1-yl)sulfonyl-1-prop-2-enylcyclohexa-2,4-dien-1-ol (PubChem CID 67914268) has the molecular formula C18H22O4S and a molecular weight of 334.44 g/mol. Its IUPAC name is 4-(4-hydroxy-4-prop-2-enylcyclohexa-1,5-dien-1-yl)sulfonyl-1-prop-2-enylcyclohexa-2,4-dien-1-ol.
| Compound Name | 4-(4-hydroxy-4-prop-2-enylcyclohexa-1,5-dien-1-yl)sulfonyl-1-prop-2-enylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 67914268 |
| Molecular Formula | C18H22O4S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 4-(4-hydroxy-4-prop-2-enylcyclohexa-1,5-dien-1-yl)sulfonyl-1-prop-2-enylcyclohexa-2,4-dien-1-ol |
| SMILES | C=CCC1(O)C=CC(S(=O)(=O)C2=CCC(O)(CC=C)C=C2)=CC1 |
| InChI | InChI=1S/C18H22O4S/c1-3-9-17(19)11-5-15(6-12-17)23(21,22)16-7-13-18(20,10-4-2)14-8-16/h3-8,11,13,19-20H,1-2,9-10,12,14H2 |
| InChIKey | ORBLNKQRTQFPIS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|