C54H62N8 — CID 67914458
5-[(2,6-dimethylphenyl)methyl]-2-[1,3,9-tris(2,6-dimethylphenyl)-2,6,7-tris(1H-imidazol-5-yl)nonyl]-1H-imidazole (PubChem CID 67914458) has the molecular formula C54H62N8 and a molecular weight of 823.15 g/mol. Its IUPAC name is 5-[(2,6-dimethylphenyl)methyl]-2-[1,3,9-tris(2,6-dimethylphenyl)-2,6,7-tris(1H-imidazol-5-yl)nonyl]-1H-imidazole.
| Compound Name | 5-[(2,6-dimethylphenyl)methyl]-2-[1,3,9-tris(2,6-dimethylphenyl)-2,6,7-tris(1H-imidazol-5-yl)nonyl]-1H-imidazole |
|---|---|
| PubChem CID | 67914458 |
| Molecular Formula | C54H62N8 |
| Molecular Weight | 823.15 g/mol |
| Exact Mass | 822.51 |
| IUPAC Name | 5-[(2,6-dimethylphenyl)methyl]-2-[1,3,9-tris(2,6-dimethylphenyl)-2,6,7-tris(1H-imidazol-5-yl)nonyl]-1H-imidazole |
| SMILES | Cc1cccc(C)c1CCC(c1cnc[nH]1)C(CCC(c1c(C)cccc1C)C(c1cnc[nH]1)C(c1ncc(Cc2c(C)cccc2C)[nH]1)c1c(C)cccc1C)c1cnc[nH]1 |
| InChI | InChI=1S/C54H62N8/c1-33-13-9-14-34(2)42(33)21-22-43(47-27-55-30-59-47)44(48-28-56-31-60-48)23-24-45(50-37(5)17-11-18-38(50)6)52(49-29-57-32-61-49)53(51-39(7)19-12-20-40(51)8)54-58-26-41(62-54)25-46-35(3)15-10-16-36(46)4/h9-20,26-32,43-45,52-53H,21-25H2,1-8H3,(H,55,59)(H,56,60)(H,57,61)(H,58,62) |
| InChIKey | WKGCMTDKNBSUJK-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.15 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |