C21H27BrO3 — CID 67914733
(8S,10S,13S,14S,17S)-17-(2-bromoethyl)-17-hydroxy-10,13-dimethyl-1,6,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-2,3-dione (PubChem CID 67914733) has the molecular formula C21H27BrO3 and a molecular weight of 407.35 g/mol. Its IUPAC name is (8S,10S,13S,14S,17S)-17-(2-bromoethyl)-17-hydroxy-10,13-dimethyl-1,6,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-2,3-dione.
| Compound Name | (8S,10S,13S,14S,17S)-17-(2-bromoethyl)-17-hydroxy-10,13-dimethyl-1,6,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-2,3-dione |
|---|---|
| PubChem CID | 67914733 |
| Molecular Formula | C21H27BrO3 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | (8S,10S,13S,14S,17S)-17-(2-bromoethyl)-17-hydroxy-10,13-dimethyl-1,6,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-2,3-dione |
| SMILES | C[C@]12CC(=O)C(=O)C=C1CC[C@@H]1C2=CC[C@@]2(C)[C@H]1CC[C@]2(O)CCBr |
| InChI | InChI=1S/C21H27BrO3/c1-19-12-18(24)17(23)11-13(19)3-4-14-15(19)5-7-20(2)16(14)6-8-21(20,25)9-10-22/h5,11,14,16,25H,3-4,6-10,12H2,1-2H3/t14-,16+,19+,20+,21+/m1/s1 |
| InChIKey | CNAYBDWGUZDBPO-MOXZGWPVSA-N |
| XLogP | 4.13 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|