About (E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one
(E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one (PubChem CID 67914886) has the molecular formula C22H41NO
and a molecular weight of 335.58 g/mol. Its IUPAC name is (E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one |
| PubChem CID | 67914886 |
| Molecular Formula | C22H41NO |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.32 |
| IUPAC Name | (E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one |
| SMILES | C/C=C/CCCCCCCCCCC(=O)C1CC(C)CNC(C)C1 |
| InChI | InChI=1S/C22H41NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-22(24)21-16-19(2)18-23-20(3)17-21/h4-5,19-21,23H,6-18H2,1-3H3/b5-4+ |
| InChIKey | KIVZWZDBKNMUST-SNAWJCMRSA-N |
| XLogP | 6.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one?
The IUPAC name of (E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one (CID 67914886) is (E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one.
What is the SMILES notation for (E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one?
The canonical SMILES for (E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one is C/C=C/CCCCCCCCCCC(=O)C1CC(C)CNC(C)C1.
What is the InChIKey of (E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one?
The InChIKey is KIVZWZDBKNMUST-SNAWJCMRSA-N. The full InChI is InChI=1S/C22H41NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-22(24)21-16-19(2)18-23-20(3)17-21/h4-5,19-21,23H,6-18H2,1-3H3/b5-4+.
What are the key properties of (E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one?
(E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one has a molecular weight of 335.58 g/mol, XLogP of 6.06, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2,6-dimethylazepan-4-yl)tetradec-12-en-1-one is sourced from PubChem (CID 67914886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).