About (5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone
(5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone (PubChem CID 67914997) has the molecular formula C24H17N3O2S
and a molecular weight of 411.49 g/mol. Its IUPAC name is (5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | (5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone |
| PubChem CID | 67914997 |
| Molecular Formula | C24H17N3O2S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1csc(-c2cccnc2)n1)c1c[nH]c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C24H17N3O2S/c28-23(22-15-30-24(27-22)17-7-4-10-25-12-17)20-13-26-21-9-8-18(11-19(20)21)29-14-16-5-2-1-3-6-16/h1-13,15,26H,14H2 |
| InChIKey | HYLQTHQUWGGJCW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone?
The IUPAC name of (5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone (CID 67914997) is (5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone.
What is the SMILES notation for (5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone?
The canonical SMILES for (5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone is O=C(c1csc(-c2cccnc2)n1)c1c[nH]c2ccc(OCc3ccccc3)cc12.
What is the InChIKey of (5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone?
The InChIKey is HYLQTHQUWGGJCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17N3O2S/c28-23(22-15-30-24(27-22)17-7-4-10-25-12-17)20-13-26-21-9-8-18(11-19(20)21)29-14-16-5-2-1-3-6-16/h1-13,15,26H,14H2.
What are the key properties of (5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone?
(5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone has a molecular weight of 411.49 g/mol, XLogP of 5.50, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-phenylmethoxy-1H-indol-3-yl)-(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 67914997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).