About 3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine
3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine (PubChem CID 67915677) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine.
Molecular Properties
| Compound Name | 3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine |
| PubChem CID | 67915677 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine |
| SMILES | COC(CN1CC=CN(c2ccccc2)N1)OC |
| InChI | InChI=1S/C13H19N3O2/c1-17-13(18-2)11-15-9-6-10-16(14-15)12-7-4-3-5-8-12/h3-8,10,13-14H,9,11H2,1-2H3 |
| InChIKey | NHIKOGCKOMYWIL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine?
The IUPAC name of 3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine (CID 67915677) is 3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine.
What is the SMILES notation for 3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine?
The canonical SMILES for 3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine is COC(CN1CC=CN(c2ccccc2)N1)OC.
What is the InChIKey of 3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine?
The InChIKey is NHIKOGCKOMYWIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-17-13(18-2)11-15-9-6-10-16(14-15)12-7-4-3-5-8-12/h3-8,10,13-14H,9,11H2,1-2H3.
What are the key properties of 3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine?
3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine has a molecular weight of 249.31 g/mol, XLogP of 1.36, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethoxyethyl)-1-phenyl-2,4-dihydrotriazine is sourced from PubChem (CID 67915677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).